C8H13NO3 — CID 67815076
(2S)-2-amino-3-hydroxypropanoic acid;cyclopenta-1,3-diene (PubChem CID 67815076) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxypropanoic acid;cyclopenta-1,3-diene.
| Compound Name | (2S)-2-amino-3-hydroxypropanoic acid;cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 67815076 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (2S)-2-amino-3-hydroxypropanoic acid;cyclopenta-1,3-diene |
| SMILES | C1=CCC=C1.N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C5H6.C3H7NO3/c1-2-4-5-3-1;4-2(1-5)3(6)7/h1-4H,5H2;2,5H,1,4H2,(H,6,7)/t;2-/m.0/s1 |
| InChIKey | ZSNPKFLFURGNOF-WNQIDUERSA-N |
| XLogP | -0.11 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |