C23H32N4 — CID 67817161
5-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]-4-N-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]pentane-1,4-diamine (PubChem CID 67817161) has the molecular formula C23H32N4 and a molecular weight of 364.54 g/mol. Its IUPAC name is 5-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]-4-N-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]pentane-1,4-diamine.
| Compound Name | 5-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]-4-N-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 67817161 |
| Molecular Formula | C23H32N4 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 5-[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]-4-N-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]pentane-1,4-diamine |
| SMILES | NCCCC(C[C@@H]1Cc2ccccc2CN1)N[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C23H32N4/c24-12-4-10-20(15-21-14-18-6-1-2-7-19(18)16-26-21)27-22-11-3-8-17-9-5-13-25-23(17)22/h1-2,5-7,9,13,20-22,26-27H,3-4,8,10-12,14-16,24H2/t20?,21-,22-/m0/s1 |
| InChIKey | NTRJPOGNAABBCD-QIFDKBNDSA-N |
| XLogP | 3.26 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |