C17H23NO5 — CID 67820573
tert-butyl N-[3-[2-[(2R)-4-hydroxy-5-oxooxolan-2-yl]ethyl]phenyl]carbamate (PubChem CID 67820573) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[(2R)-4-hydroxy-5-oxooxolan-2-yl]ethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[(2R)-4-hydroxy-5-oxooxolan-2-yl]ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 67820573 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | tert-butyl N-[3-[2-[(2R)-4-hydroxy-5-oxooxolan-2-yl]ethyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(CC[C@@H]2CC(O)C(=O)O2)c1 |
| InChI | InChI=1S/C17H23NO5/c1-17(2,3)23-16(21)18-12-6-4-5-11(9-12)7-8-13-10-14(19)15(20)22-13/h4-6,9,13-14,19H,7-8,10H2,1-3H3,(H,18,21)/t13-,14?/m1/s1 |
| InChIKey | ILRUBUHZNKAHKN-KWCCSABGSA-N |
| XLogP | 2.64 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |