C24H31F3NO4Si — CID 67821106
CID 67821106 (PubChem CID 67821106) has the molecular formula C24H31F3NO4Si and a molecular weight of 482.60 g/mol.
| Compound Name | CID 67821106 |
|---|---|
| PubChem CID | 67821106 |
| Molecular Formula | C24H31F3NO4Si |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | — |
| SMILES | C[Si](C)OCc1c(C(C)(C)C)ccn([C@@H]2c3cc(C(F)(F)F)ccc3OC(C)(C)[C@H]2O)c1=O |
| InChI | InChI=1S/C24H31F3NO4Si/c1-22(2,3)17-10-11-28(21(30)16(17)13-31-33(6)7)19-15-12-14(24(25,26)27)8-9-18(15)32-23(4,5)20(19)29/h8-12,19-20,29H,13H2,1-7H3/t19-,20+/m1/s1 |
| InChIKey | LSWQSSQZPSCUQA-UXHICEINSA-N |
| XLogP | 5.05 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|