C21H21F3N2O7 — CID 67821420
[2,2-dimethyl-4-[4-(1-nitrooxyethyl)-2-oxo-1-pyridinyl]-6-(trifluoromethyl)-3,4-dihydrochromen-3-yl] acetate (PubChem CID 67821420) has the molecular formula C21H21F3N2O7 and a molecular weight of 470.40 g/mol. Its IUPAC name is [2,2-dimethyl-4-[4-(1-nitrooxyethyl)-2-oxo-1-pyridinyl]-6-(trifluoromethyl)-3,4-dihydrochromen-3-yl] acetate.
| Compound Name | [2,2-dimethyl-4-[4-(1-nitrooxyethyl)-2-oxo-1-pyridinyl]-6-(trifluoromethyl)-3,4-dihydrochromen-3-yl] acetate |
|---|---|
| PubChem CID | 67821420 |
| Molecular Formula | C21H21F3N2O7 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | [2,2-dimethyl-4-[4-(1-nitrooxyethyl)-2-oxo-1-pyridinyl]-6-(trifluoromethyl)-3,4-dihydrochromen-3-yl] acetate |
| SMILES | CC(=O)OC1C(n2ccc(C(C)O[N+](=O)[O-])cc2=O)c2cc(C(F)(F)F)ccc2OC1(C)C |
| InChI | InChI=1S/C21H21F3N2O7/c1-11(33-26(29)30)13-7-8-25(17(28)9-13)18-15-10-14(21(22,23)24)5-6-16(15)32-20(3,4)19(18)31-12(2)27/h5-11,18-19H,1-4H3 |
| InChIKey | WBAYZDNVFUCSHV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 109.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|