C18H22N2O4 — CID 67824794
4-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-quinolin-2-ylpentanoic acid (PubChem CID 67824794) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-quinolin-2-ylpentanoic acid.
| Compound Name | 4-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-quinolin-2-ylpentanoic acid |
|---|---|
| PubChem CID | 67824794 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxo-4-quinolin-2-ylpentanoic acid |
| SMILES | CC(C)(C)OC(=O)C(N)(CCC(=O)O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H22N2O4/c1-17(2,3)24-16(23)18(19,11-10-15(21)22)14-9-8-12-6-4-5-7-13(12)20-14/h4-9H,10-11,19H2,1-3H3,(H,21,22) |
| InChIKey | CJGOFMDWGBLKSO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |