About ethyl spiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl carbonate
ethyl spiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl carbonate (PubChem CID 67827597) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is ethyl spiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl carbonate.
Analyze ethyl spiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl spiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl carbonate?
The IUPAC name of ethyl spiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl carbonate (CID 67827597) is ethyl spiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl carbonate.
What is the SMILES notation for ethyl spiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl carbonate?
The canonical SMILES for ethyl spiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl carbonate is CCOC(=O)OC1CC2CC1CC21CCNC1.
What is the InChIKey of ethyl spiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl carbonate?
The InChIKey is NKGIJOCZVMYMJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3/c1-2-16-12(15)17-11-6-10-5-9(11)7-13(10)3-4-14-8-13/h9-11,14H,2-8H2,1H3.
What are the key properties of ethyl spiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl carbonate?
ethyl spiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl carbonate has a molecular weight of 239.31 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl spiro[bicyclo[2.2.1]heptane-5,3'-pyrrolidine]-2-yl carbonate is sourced from PubChem (CID 67827597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).