C21H29N3O6 — CID 67828176
ethyl 1-amino-2-(2-aminoacetyl)-2-[2-(phenylmethoxycarbonylamino)propanoyl]cyclopentane-1-carboxylate (PubChem CID 67828176) has the molecular formula C21H29N3O6 and a molecular weight of 419.48 g/mol. Its IUPAC name is ethyl 1-amino-2-(2-aminoacetyl)-2-[2-(phenylmethoxycarbonylamino)propanoyl]cyclopentane-1-carboxylate.
| Compound Name | ethyl 1-amino-2-(2-aminoacetyl)-2-[2-(phenylmethoxycarbonylamino)propanoyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 67828176 |
| Molecular Formula | C21H29N3O6 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | ethyl 1-amino-2-(2-aminoacetyl)-2-[2-(phenylmethoxycarbonylamino)propanoyl]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(N)CCCC1(C(=O)CN)C(=O)C(C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29N3O6/c1-3-29-18(27)21(23)11-7-10-20(21,16(25)12-22)17(26)14(2)24-19(28)30-13-15-8-5-4-6-9-15/h4-6,8-9,14H,3,7,10-13,22-23H2,1-2H3,(H,24,28) |
| InChIKey | KLSYULPYVQKVKG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 150.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|