C22H28O4 — CID 67830905
ethane-1,2-diol;phenol;1,4-xylene (PubChem CID 67830905) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is ethane-1,2-diol;phenol;1,4-xylene.
| Compound Name | ethane-1,2-diol;phenol;1,4-xylene |
|---|---|
| PubChem CID | 67830905 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | ethane-1,2-diol;phenol;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.OCCO.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C8H10.2C6H6O.C2H6O2/c1-7-3-5-8(2)6-4-7;2*7-6-4-2-1-3-5-6;3-1-2-4/h3-6H,1-2H3;2*1-5,7H;3-4H,1-2H2 |
| InChIKey | PKPALBCUQKFPMT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |