C16H13ClN2O5 — CID 678326
(2R)-4-(4-chlorophenyl)-2-(3-nitroanilino)-4-oxobutanoic acid (PubChem CID 678326) has the molecular formula C16H13ClN2O5 and a molecular weight of 348.74 g/mol. Its IUPAC name is (2R)-4-(4-chlorophenyl)-2-(3-nitroanilino)-4-oxobutanoic acid.
| Compound Name | (2R)-4-(4-chlorophenyl)-2-(3-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 678326 |
| Molecular Formula | C16H13ClN2O5 |
| Molecular Weight | 348.74 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | (2R)-4-(4-chlorophenyl)-2-(3-nitroanilino)-4-oxobutanoic acid |
| SMILES | O=C(C[C@@H](Nc1cccc([N+](=O)[O-])c1)C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClN2O5/c17-11-6-4-10(5-7-11)15(20)9-14(16(21)22)18-12-2-1-3-13(8-12)19(23)24/h1-8,14,18H,9H2,(H,21,22)/t14-/m1/s1 |
| InChIKey | PBHIBVXXJCVTPO-CQSZACIVSA-N |
| XLogP | 3.39 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.74 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|