C17H20Cl2N4O2S — CID 67839080
2,4-dichloro-N-[[2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutylidene]amino]aniline (PubChem CID 67839080) has the molecular formula C17H20Cl2N4O2S and a molecular weight of 415.35 g/mol. Its IUPAC name is 2,4-dichloro-N-[[2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutylidene]amino]aniline.
| Compound Name | 2,4-dichloro-N-[[2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutylidene]amino]aniline |
|---|---|
| PubChem CID | 67839080 |
| Molecular Formula | C17H20Cl2N4O2S |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 2,4-dichloro-N-[[2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutylidene]amino]aniline |
| SMILES | COc1cc(OC)nc(SC(C=NNc2ccc(Cl)cc2Cl)C(C)C)n1 |
| InChI | InChI=1S/C17H20Cl2N4O2S/c1-10(2)14(9-20-23-13-6-5-11(18)7-12(13)19)26-17-21-15(24-3)8-16(22-17)25-4/h5-10,14,23H,1-4H3 |
| InChIKey | MHCPHCIVEHVUPO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|