C22H28N2O2 — CID 67844812
methyl 3-[4-[(4-piperidin-4-ylphenyl)methylamino]phenyl]propanoate (PubChem CID 67844812) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is methyl 3-[4-[(4-piperidin-4-ylphenyl)methylamino]phenyl]propanoate.
| Compound Name | methyl 3-[4-[(4-piperidin-4-ylphenyl)methylamino]phenyl]propanoate |
|---|---|
| PubChem CID | 67844812 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | methyl 3-[4-[(4-piperidin-4-ylphenyl)methylamino]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(NCc2ccc(C3CCNCC3)cc2)cc1 |
| InChI | InChI=1S/C22H28N2O2/c1-26-22(25)11-6-17-4-9-21(10-5-17)24-16-18-2-7-19(8-3-18)20-12-14-23-15-13-20/h2-5,7-10,20,23-24H,6,11-16H2,1H3 |
| InChIKey | MMOFQDHLMBYPHC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |