C22H26BrClN2O3 — CID 67844601
methyl 3-[3-bromo-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride (PubChem CID 67844601) has the molecular formula C22H26BrClN2O3 and a molecular weight of 481.82 g/mol. Its IUPAC name is methyl 3-[3-bromo-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride.
| Compound Name | methyl 3-[3-bromo-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 67844601 |
| Molecular Formula | C22H26BrClN2O3 |
| Molecular Weight | 481.82 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | methyl 3-[3-bromo-4-[(4-piperidin-4-ylbenzoyl)amino]phenyl]propanoate;hydrochloride |
| SMILES | COC(=O)CCc1ccc(NC(=O)c2ccc(C3CCNCC3)cc2)c(Br)c1.Cl |
| InChI | InChI=1S/C22H25BrN2O3.ClH/c1-28-21(26)9-3-15-2-8-20(19(23)14-15)25-22(27)18-6-4-16(5-7-18)17-10-12-24-13-11-17;/h2,4-8,14,17,24H,3,9-13H2,1H3,(H,25,27);1H |
| InChIKey | GEIGAPWLEZDLBK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.82 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |