C21H25ClN2O3 — CID 67844932
3-[4-[(4-piperidin-4-ylphenyl)carbamoyl]phenyl]propanoic acid;hydrochloride (PubChem CID 67844932) has the molecular formula C21H25ClN2O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is 3-[4-[(4-piperidin-4-ylphenyl)carbamoyl]phenyl]propanoic acid;hydrochloride.
| Compound Name | 3-[4-[(4-piperidin-4-ylphenyl)carbamoyl]phenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 67844932 |
| Molecular Formula | C21H25ClN2O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3-[4-[(4-piperidin-4-ylphenyl)carbamoyl]phenyl]propanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCc1ccc(C(=O)Nc2ccc(C3CCNCC3)cc2)cc1 |
| InChI | InChI=1S/C21H24N2O3.ClH/c24-20(25)10-3-15-1-4-18(5-2-15)21(26)23-19-8-6-16(7-9-19)17-11-13-22-14-12-17;/h1-2,4-9,17,22H,3,10-14H2,(H,23,26)(H,24,25);1H |
| InChIKey | QDHDOTAVDZFODM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |