C25H27ClN2O6 — CID 67845426
but-2-enedioic acid;6-chloro-2-[[1-(2-phenylethyl)piperidin-4-yl]methyl]-1,2-benzoxazol-3-one (PubChem CID 67845426) has the molecular formula C25H27ClN2O6 and a molecular weight of 486.95 g/mol. Its IUPAC name is but-2-enedioic acid;6-chloro-2-[[1-(2-phenylethyl)piperidin-4-yl]methyl]-1,2-benzoxazol-3-one.
| Compound Name | but-2-enedioic acid;6-chloro-2-[[1-(2-phenylethyl)piperidin-4-yl]methyl]-1,2-benzoxazol-3-one |
|---|---|
| PubChem CID | 67845426 |
| Molecular Formula | C25H27ClN2O6 |
| Molecular Weight | 486.95 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | but-2-enedioic acid;6-chloro-2-[[1-(2-phenylethyl)piperidin-4-yl]methyl]-1,2-benzoxazol-3-one |
| SMILES | O=C(O)C=CC(=O)O.O=c1c2ccc(Cl)cc2on1CC1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23ClN2O2.C4H4O4/c22-18-6-7-19-20(14-18)26-24(21(19)25)15-17-9-12-23(13-10-17)11-8-16-4-2-1-3-5-16;5-3(6)1-2-4(7)8/h1-7,14,17H,8-13,15H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | WOKWZFGAKPLPEV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.95 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|