C23H36N6O7 — CID 67848193
4-amino-2-[[2-(2-aminopropanoylamino)-3-phenylpropanoyl]-(2,6-diaminohexanoyl)amino]-5-hydroxy-3-oxopentanoic acid (PubChem CID 67848193) has the molecular formula C23H36N6O7 and a molecular weight of 508.58 g/mol. Its IUPAC name is 4-amino-2-[[2-(2-aminopropanoylamino)-3-phenylpropanoyl]-(2,6-diaminohexanoyl)amino]-5-hydroxy-3-oxopentanoic acid.
| Compound Name | 4-amino-2-[[2-(2-aminopropanoylamino)-3-phenylpropanoyl]-(2,6-diaminohexanoyl)amino]-5-hydroxy-3-oxopentanoic acid |
|---|---|
| PubChem CID | 67848193 |
| Molecular Formula | C23H36N6O7 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 4-amino-2-[[2-(2-aminopropanoylamino)-3-phenylpropanoyl]-(2,6-diaminohexanoyl)amino]-5-hydroxy-3-oxopentanoic acid |
| SMILES | CC(N)C(=O)NC(Cc1ccccc1)C(=O)N(C(=O)C(N)CCCCN)C(C(=O)O)C(=O)C(N)CO |
| InChI | InChI=1S/C23H36N6O7/c1-13(25)20(32)28-17(11-14-7-3-2-4-8-14)22(34)29(21(33)15(26)9-5-6-10-24)18(23(35)36)19(31)16(27)12-30/h2-4,7-8,13,15-18,30H,5-6,9-12,24-27H2,1H3,(H,28,32)(H,35,36) |
| InChIKey | LRTKJLMRBCCTJJ-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 245.16 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|