C24H26N2O4S — CID 67848975
benzhydrylsulfamoyl-(2-tert-butylphenyl)carbamic acid (PubChem CID 67848975) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is benzhydrylsulfamoyl-(2-tert-butylphenyl)carbamic acid.
| Compound Name | benzhydrylsulfamoyl-(2-tert-butylphenyl)carbamic acid |
|---|---|
| PubChem CID | 67848975 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | benzhydrylsulfamoyl-(2-tert-butylphenyl)carbamic acid |
| SMILES | CC(C)(C)c1ccccc1N(C(=O)O)S(=O)(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26N2O4S/c1-24(2,3)20-16-10-11-17-21(20)26(23(27)28)31(29,30)25-22(18-12-6-4-7-13-18)19-14-8-5-9-15-19/h4-17,22,25H,1-3H3,(H,27,28) |
| InChIKey | ZRZOLELYFNTROW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |