C5H9N3O2 — CID 67863544
1-N'-cyclopropyl-2-nitroethene-1,1-diamine (PubChem CID 67863544) has the molecular formula C5H9N3O2 and a molecular weight of 143.15 g/mol. Its IUPAC name is 1-N'-cyclopropyl-2-nitroethene-1,1-diamine.
| Compound Name | 1-N'-cyclopropyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 67863544 |
| Molecular Formula | C5H9N3O2 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 1-N'-cyclopropyl-2-nitroethene-1,1-diamine |
| SMILES | NC(=C[N+](=O)[O-])NC1CC1 |
| InChI | InChI=1S/C5H9N3O2/c6-5(3-8(9)10)7-4-1-2-4/h3-4,7H,1-2,6H2 |
| InChIKey | VOZDUBVHFBHSOL-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|