C25H34FNO — CID 67864036
3-fluoro-4-[(E)-3-[4-[(1R,3R)-3-propylcyclohexyl]cyclohexyl]prop-2-enoxy]benzonitrile (PubChem CID 67864036) has the molecular formula C25H34FNO and a molecular weight of 383.55 g/mol. Its IUPAC name is 3-fluoro-4-[(E)-3-[4-[(1R,3R)-3-propylcyclohexyl]cyclohexyl]prop-2-enoxy]benzonitrile.
| Compound Name | 3-fluoro-4-[(E)-3-[4-[(1R,3R)-3-propylcyclohexyl]cyclohexyl]prop-2-enoxy]benzonitrile |
|---|---|
| PubChem CID | 67864036 |
| Molecular Formula | C25H34FNO |
| Molecular Weight | 383.55 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 3-fluoro-4-[(E)-3-[4-[(1R,3R)-3-propylcyclohexyl]cyclohexyl]prop-2-enoxy]benzonitrile |
| SMILES | CCC[C@@H]1CCC[C@@H](C2CCC(/C=C/COc3ccc(C#N)cc3F)CC2)C1 |
| InChI | InChI=1S/C25H34FNO/c1-2-5-20-6-3-8-23(16-20)22-12-9-19(10-13-22)7-4-15-28-25-14-11-21(18-27)17-24(25)26/h4,7,11,14,17,19-20,22-23H,2-3,5-6,8-10,12-13,15-16H2,1H3/b7-4+/t19?,20-,22?,23-/m1/s1 |
| InChIKey | ISFQBFUWTNJSJU-BHPZUUKASA-N |
| XLogP | 7.05 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.55 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|