C26H38N2O2 — CID 67865092
5-[(2S)-octan-2-yl]oxy-2-[4-[(Z)-oct-5-enoxy]phenyl]pyrimidine (PubChem CID 67865092) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is 5-[(2S)-octan-2-yl]oxy-2-[4-[(Z)-oct-5-enoxy]phenyl]pyrimidine.
| Compound Name | 5-[(2S)-octan-2-yl]oxy-2-[4-[(Z)-oct-5-enoxy]phenyl]pyrimidine |
|---|---|
| PubChem CID | 67865092 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 5-[(2S)-octan-2-yl]oxy-2-[4-[(Z)-oct-5-enoxy]phenyl]pyrimidine |
| SMILES | CC/C=C\CCCCOc1ccc(-c2ncc(O[C@@H](C)CCCCCC)cn2)cc1 |
| InChI | InChI=1S/C26H38N2O2/c1-4-6-8-10-11-13-19-29-24-17-15-23(16-18-24)26-27-20-25(21-28-26)30-22(3)14-12-9-7-5-2/h6,8,15-18,20-22H,4-5,7,9-14,19H2,1-3H3/b8-6-/t22-/m0/s1 |
| InChIKey | FZGDMTBFJZZXLO-QGHLFXPHSA-N |
| XLogP | 7.40 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|