C32H41N5O8 — CID 67871086
but-2-enedioic acid;N-[4-[3-[3-[2-(diethylamino)ethyl]-1H-indol-5-yl]-3-(2,5-dioxoimidazolidin-4-yl)propyl]phenyl]acetamide;hydrate (PubChem CID 67871086) has the molecular formula C32H41N5O8 and a molecular weight of 623.71 g/mol. Its IUPAC name is but-2-enedioic acid;N-[4-[3-[3-[2-(diethylamino)ethyl]-1H-indol-5-yl]-3-(2,5-dioxoimidazolidin-4-yl)propyl]phenyl]acetamide;hydrate.
| Compound Name | but-2-enedioic acid;N-[4-[3-[3-[2-(diethylamino)ethyl]-1H-indol-5-yl]-3-(2,5-dioxoimidazolidin-4-yl)propyl]phenyl]acetamide;hydrate |
|---|---|
| PubChem CID | 67871086 |
| Molecular Formula | C32H41N5O8 |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | but-2-enedioic acid;N-[4-[3-[3-[2-(diethylamino)ethyl]-1H-indol-5-yl]-3-(2,5-dioxoimidazolidin-4-yl)propyl]phenyl]acetamide;hydrate |
| SMILES | CCN(CC)CCc1c[nH]c2ccc(C(CCc3ccc(NC(C)=O)cc3)C3NC(=O)NC3=O)cc12.O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C28H35N5O3.C4H4O4.H2O/c1-4-33(5-2)15-14-21-17-29-25-13-9-20(16-24(21)25)23(26-27(35)32-28(36)31-26)12-8-19-6-10-22(11-7-19)30-18(3)34;5-3(6)1-2-4(7)8;/h6-7,9-11,13,16-17,23,26,29H,4-5,8,12,14-15H2,1-3H3,(H,30,34)(H2,31,32,35,36);1-2H,(H,5,6)(H,7,8);1H2 |
| InChIKey | PHTGZIXXSXUAQR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 212.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|