C13H19NO7 — CID 67879819
[5-(2-methoxyethoxycarbonyloxy)-1,4-dihydropyridin-3-yl] propan-2-yl carbonate (PubChem CID 67879819) has the molecular formula C13H19NO7 and a molecular weight of 301.30 g/mol. Its IUPAC name is [5-(2-methoxyethoxycarbonyloxy)-1,4-dihydropyridin-3-yl] propan-2-yl carbonate.
| Compound Name | [5-(2-methoxyethoxycarbonyloxy)-1,4-dihydropyridin-3-yl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 67879819 |
| Molecular Formula | C13H19NO7 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | [5-(2-methoxyethoxycarbonyloxy)-1,4-dihydropyridin-3-yl] propan-2-yl carbonate |
| SMILES | COCCOC(=O)OC1=CNC=C(OC(=O)OC(C)C)C1 |
| InChI | InChI=1S/C13H19NO7/c1-9(2)19-13(16)21-11-6-10(7-14-8-11)20-12(15)18-5-4-17-3/h7-9,14H,4-6H2,1-3H3 |
| InChIKey | RCWSYENNJQPEBL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|