C34H37N3O3 — CID 67881204
benzyl N-[[3-[3-(1-benzylpiperidin-4-yl)prop-2-enoyl]-1-methylindol-5-yl]methyl]-N-methylcarbamate (PubChem CID 67881204) has the molecular formula C34H37N3O3 and a molecular weight of 535.69 g/mol. Its IUPAC name is benzyl N-[[3-[3-(1-benzylpiperidin-4-yl)prop-2-enoyl]-1-methylindol-5-yl]methyl]-N-methylcarbamate.
| Compound Name | benzyl N-[[3-[3-(1-benzylpiperidin-4-yl)prop-2-enoyl]-1-methylindol-5-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 67881204 |
| Molecular Formula | C34H37N3O3 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | benzyl N-[[3-[3-(1-benzylpiperidin-4-yl)prop-2-enoyl]-1-methylindol-5-yl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1ccc2c(c1)c(C(=O)C=CC1CCN(Cc3ccccc3)CC1)cn2C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H37N3O3/c1-35-24-31(33(38)16-14-26-17-19-37(20-18-26)23-27-9-5-3-6-10-27)30-21-29(13-15-32(30)35)22-36(2)34(39)40-25-28-11-7-4-8-12-28/h3-16,21,24,26H,17-20,22-23,25H2,1-2H3 |
| InChIKey | NFJGSEOCXDERCY-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|