C22H25NO4 — CID 67884363
4-[(3R)-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyrrol-5-yl]butanoic acid (PubChem CID 67884363) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is 4-[(3R)-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyrrol-5-yl]butanoic acid.
| Compound Name | 4-[(3R)-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyrrol-5-yl]butanoic acid |
|---|---|
| PubChem CID | 67884363 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 4-[(3R)-3,4-bis(phenylmethoxy)-3,4-dihydro-2H-pyrrol-5-yl]butanoic acid |
| SMILES | O=C(O)CCCC1=NC[C@@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C22H25NO4/c24-21(25)13-7-12-19-22(27-16-18-10-5-2-6-11-18)20(14-23-19)26-15-17-8-3-1-4-9-17/h1-6,8-11,20,22H,7,12-16H2,(H,24,25)/t20-,22?/m1/s1 |
| InChIKey | VOEDLYITDOMIHJ-PSDZMVHGSA-N |
| XLogP | 3.87 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |