C16H18N2O4S — CID 91562739
4-(5-phenylmethoxycarbonyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidin-4-yl)butanoic acid (PubChem CID 91562739) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 4-(5-phenylmethoxycarbonyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidin-4-yl)butanoic acid.
| Compound Name | 4-(5-phenylmethoxycarbonyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidin-4-yl)butanoic acid |
|---|---|
| PubChem CID | 91562739 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-(5-phenylmethoxycarbonyl-2-sulfanylidene-5,6-dihydro-1H-pyrimidin-4-yl)butanoic acid |
| SMILES | O=C(O)CCCC1=NC(=S)NCC1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H18N2O4S/c19-14(20)8-4-7-13-12(9-17-16(23)18-13)15(21)22-10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,17,23)(H,19,20) |
| InChIKey | HWILLRQHXIVTAQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|