C16H14FN5O3 — CID 67887028
2-[3-(7-fluoro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-1,2,4-oxadiazol-5-yl]propan-2-ol (PubChem CID 67887028) has the molecular formula C16H14FN5O3 and a molecular weight of 343.32 g/mol. Its IUPAC name is 2-[3-(7-fluoro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-1,2,4-oxadiazol-5-yl]propan-2-ol.
| Compound Name | 2-[3-(7-fluoro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-1,2,4-oxadiazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 67887028 |
| Molecular Formula | C16H14FN5O3 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[3-(7-fluoro-4-methyl-5-oxidoimidazo[1,5-a]quinoxalin-5-ium-3-yl)-1,2,4-oxadiazol-5-yl]propan-2-ol |
| SMILES | Cc1c2c(-c3noc(C(C)(C)O)n3)ncn2c2ccc(F)cc2[n+]1[O-] |
| InChI | InChI=1S/C16H14FN5O3/c1-8-13-12(14-19-15(25-20-14)16(2,3)23)18-7-21(13)10-5-4-9(17)6-11(10)22(8)24/h4-7,23H,1-3H3 |
| InChIKey | IBDGNVPHNHMSQG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|