C18H27N7O2 — CID 67889016
[6-[2-[(N'-heptylcarbamimidoyl)amino]-1,3-oxazol-4-yl]-2-pyridinyl]methylurea (PubChem CID 67889016) has the molecular formula C18H27N7O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is [6-[2-[(N'-heptylcarbamimidoyl)amino]-1,3-oxazol-4-yl]-2-pyridinyl]methylurea.
| Compound Name | [6-[2-[(N'-heptylcarbamimidoyl)amino]-1,3-oxazol-4-yl]-2-pyridinyl]methylurea |
|---|---|
| PubChem CID | 67889016 |
| Molecular Formula | C18H27N7O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | [6-[2-[(N'-heptylcarbamimidoyl)amino]-1,3-oxazol-4-yl]-2-pyridinyl]methylurea |
| SMILES | CCCCCCC/N=C(\N)Nc1nc(-c2cccc(CNC(N)=O)n2)co1 |
| InChI | InChI=1S/C18H27N7O2/c1-2-3-4-5-6-10-21-16(19)25-18-24-15(12-27-18)14-9-7-8-13(23-14)11-22-17(20)26/h7-9,12H,2-6,10-11H2,1H3,(H3,20,22,26)(H3,19,21,24,25) |
| InChIKey | GCRNIMKEPGFHGY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 144.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|