C19H20ClN — CID 67894886
(3aS,5S,9bR)-5-(4-chlorophenyl)-3-methyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole (PubChem CID 67894886) has the molecular formula C19H20ClN and a molecular weight of 297.83 g/mol. Its IUPAC name is (3aS,5S,9bR)-5-(4-chlorophenyl)-3-methyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole.
| Compound Name | (3aS,5S,9bR)-5-(4-chlorophenyl)-3-methyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole |
|---|---|
| PubChem CID | 67894886 |
| Molecular Formula | C19H20ClN |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | (3aS,5S,9bR)-5-(4-chlorophenyl)-3-methyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indole |
| SMILES | CN1CC[C@@H]2c3ccccc3[C@H](c3ccc(Cl)cc3)C[C@@H]21 |
| InChI | InChI=1S/C19H20ClN/c1-21-11-10-17-15-4-2-3-5-16(15)18(12-19(17)21)13-6-8-14(20)9-7-13/h2-9,17-19H,10-12H2,1H3/t17-,18+,19+/m1/s1 |
| InChIKey | JVRRQOSFUGPZNY-QYZOEREBSA-N |
| XLogP | 4.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |