C12H20N2O — CID 67895773
1-(1,4-diaminocyclohexa-2,4-dien-1-yl)hexan-1-one (PubChem CID 67895773) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(1,4-diaminocyclohexa-2,4-dien-1-yl)hexan-1-one.
| Compound Name | 1-(1,4-diaminocyclohexa-2,4-dien-1-yl)hexan-1-one |
|---|---|
| PubChem CID | 67895773 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(1,4-diaminocyclohexa-2,4-dien-1-yl)hexan-1-one |
| SMILES | CCCCCC(=O)C1(N)C=CC(N)=CC1 |
| InChI | InChI=1S/C12H20N2O/c1-2-3-4-5-11(15)12(14)8-6-10(13)7-9-12/h6-8H,2-5,9,13-14H2,1H3 |
| InChIKey | OKDXGCDZOPAURU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|