C19H24N2 — CID 67897149
(7R)-10-methyl-5,10-diazapentacyclo[9.7.1.17,18.02,6.012,17]icosa-1(18),2(6),12(17),15-tetraene (PubChem CID 67897149) has the molecular formula C19H24N2 and a molecular weight of 280.41 g/mol. Its IUPAC name is (7R)-10-methyl-5,10-diazapentacyclo[9.7.1.17,18.02,6.012,17]icosa-1(18),2(6),12(17),15-tetraene.
| Compound Name | (7R)-10-methyl-5,10-diazapentacyclo[9.7.1.17,18.02,6.012,17]icosa-1(18),2(6),12(17),15-tetraene |
|---|---|
| PubChem CID | 67897149 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (7R)-10-methyl-5,10-diazapentacyclo[9.7.1.17,18.02,6.012,17]icosa-1(18),2(6),12(17),15-tetraene |
| SMILES | CN1CC[C@H]2CC3=C(CC1C1=C3C=CCC1)C1=C2NCC1 |
| InChI | InChI=1S/C19H24N2/c1-21-9-7-12-10-16-13-4-2-3-5-14(13)18(21)11-17(16)15-6-8-20-19(12)15/h2,4,12,18,20H,3,5-11H2,1H3/t12-,18?/m0/s1 |
| InChIKey | BYGGTMMEHLIKRA-RSXQAXDFSA-N |
| XLogP | 3.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |