C24H35NO4 — CID 67897889
4-(dimethylamino)-2-(3-methylbutyl)benzoic acid;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione (PubChem CID 67897889) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is 4-(dimethylamino)-2-(3-methylbutyl)benzoic acid;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione.
| Compound Name | 4-(dimethylamino)-2-(3-methylbutyl)benzoic acid;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
|---|---|
| PubChem CID | 67897889 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 4-(dimethylamino)-2-(3-methylbutyl)benzoic acid;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
| SMILES | CC(C)CCc1cc(N(C)C)ccc1C(=O)O.CC12CCC(C(=O)C1=O)C2(C)C |
| InChI | InChI=1S/C14H21NO2.C10H14O2/c1-10(2)5-6-11-9-12(15(3)4)7-8-13(11)14(16)17;1-9(2)6-4-5-10(9,3)8(12)7(6)11/h7-10H,5-6H2,1-4H3,(H,16,17);6H,4-5H2,1-3H3 |
| InChIKey | GLZMPJCUQYQRNC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|