C24H32FN3O4 — CID 67902678
3-N-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxamide (PubChem CID 67902678) has the molecular formula C24H32FN3O4 and a molecular weight of 445.54 g/mol. Its IUPAC name is 3-N-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxamide.
| Compound Name | 3-N-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxamide |
|---|---|
| PubChem CID | 67902678 |
| Molecular Formula | C24H32FN3O4 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 3-N-[4-[4-(4-fluorobenzoyl)piperidin-1-yl]butyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxamide |
| SMILES | NC(=O)C1C2CCC(O2)C1C(=O)NCCCCN1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H32FN3O4/c25-17-5-3-15(4-6-17)22(29)16-9-13-28(14-10-16)12-2-1-11-27-24(31)21-19-8-7-18(32-19)20(21)23(26)30/h3-6,16,18-21H,1-2,7-14H2,(H2,26,30)(H,27,31) |
| InChIKey | MPRKKTONJOLVED-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|