C11H17NO — CID 67907519
N,N-bis(prop-2-enyl)-3,6-dihydro-2H-pyran-2-amine (PubChem CID 67907519) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-3,6-dihydro-2H-pyran-2-amine.
| Compound Name | N,N-bis(prop-2-enyl)-3,6-dihydro-2H-pyran-2-amine |
|---|---|
| PubChem CID | 67907519 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N,N-bis(prop-2-enyl)-3,6-dihydro-2H-pyran-2-amine |
| SMILES | C=CCN(CC=C)C1CC=CCO1 |
| InChI | InChI=1S/C11H17NO/c1-3-8-12(9-4-2)11-7-5-6-10-13-11/h3-6,11H,1-2,7-10H2 |
| InChIKey | SDOGYCRQHHQGHP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|