C26H34N2O4 — CID 67908563
methyl (2S,3R)-5-amino-2-benzyl-3-methyl-4-oxo-2-(6-phenylhexanoylamino)pentanoate (PubChem CID 67908563) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is methyl (2S,3R)-5-amino-2-benzyl-3-methyl-4-oxo-2-(6-phenylhexanoylamino)pentanoate.
| Compound Name | methyl (2S,3R)-5-amino-2-benzyl-3-methyl-4-oxo-2-(6-phenylhexanoylamino)pentanoate |
|---|---|
| PubChem CID | 67908563 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | methyl (2S,3R)-5-amino-2-benzyl-3-methyl-4-oxo-2-(6-phenylhexanoylamino)pentanoate |
| SMILES | COC(=O)[C@@](Cc1ccccc1)(NC(=O)CCCCCc1ccccc1)[C@@H](C)C(=O)CN |
| InChI | InChI=1S/C26H34N2O4/c1-20(23(29)19-27)26(25(31)32-2,18-22-15-9-4-10-16-22)28-24(30)17-11-5-8-14-21-12-6-3-7-13-21/h3-4,6-7,9-10,12-13,15-16,20H,5,8,11,14,17-19,27H2,1-2H3,(H,28,30)/t20-,26-/m0/s1 |
| InChIKey | JKTGRJIRBVOOQU-FNZWTVRRSA-N |
| XLogP | 3.22 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|