C30H43N3O5 — CID 70047472
tert-butyl N-[(3R,4R)-5-amino-4-benzyl-2-hydroxy-3-methyl-5-oxo-4-(6-phenylhexanoylamino)pentyl]carbamate (PubChem CID 70047472) has the molecular formula C30H43N3O5 and a molecular weight of 525.69 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-5-amino-4-benzyl-2-hydroxy-3-methyl-5-oxo-4-(6-phenylhexanoylamino)pentyl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-5-amino-4-benzyl-2-hydroxy-3-methyl-5-oxo-4-(6-phenylhexanoylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 70047472 |
| Molecular Formula | C30H43N3O5 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | tert-butyl N-[(3R,4R)-5-amino-4-benzyl-2-hydroxy-3-methyl-5-oxo-4-(6-phenylhexanoylamino)pentyl]carbamate |
| SMILES | C[C@@H](C(O)CNC(=O)OC(C)(C)C)[C@@](Cc1ccccc1)(NC(=O)CCCCCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C30H43N3O5/c1-22(25(34)21-32-28(37)38-29(2,3)4)30(27(31)36,20-24-17-11-6-12-18-24)33-26(35)19-13-7-10-16-23-14-8-5-9-15-23/h5-6,8-9,11-12,14-15,17-18,22,25,34H,7,10,13,16,19-21H2,1-4H3,(H2,31,36)(H,32,37)(H,33,35)/t22-,25?,30+/m0/s1 |
| InChIKey | OLUNVLMCCRYLSZ-NTEPSXFTSA-N |
| XLogP | 3.89 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|