C27H30N4O5S — CID 67912501
methyl 1-[(2R)-2-amino-3-(4-carbamimidoylphenyl)-2-naphthalen-2-ylsulfonylpropanoyl]piperidine-3-carboxylate (PubChem CID 67912501) has the molecular formula C27H30N4O5S and a molecular weight of 522.63 g/mol. Its IUPAC name is methyl 1-[(2R)-2-amino-3-(4-carbamimidoylphenyl)-2-naphthalen-2-ylsulfonylpropanoyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[(2R)-2-amino-3-(4-carbamimidoylphenyl)-2-naphthalen-2-ylsulfonylpropanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 67912501 |
| Molecular Formula | C27H30N4O5S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | methyl 1-[(2R)-2-amino-3-(4-carbamimidoylphenyl)-2-naphthalen-2-ylsulfonylpropanoyl]piperidine-3-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(C[C@](N)(C(=O)N2CCCC(C(=O)OC)C2)S(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C27H30N4O5S/c1-36-25(32)22-7-4-14-31(17-22)26(33)27(30,16-18-8-10-20(11-9-18)24(28)29)37(34,35)23-13-12-19-5-2-3-6-21(19)15-23/h2-3,5-6,8-13,15,22H,4,7,14,16-17,30H2,1H3,(H3,28,29)/t22?,27-/m1/s1 |
| InChIKey | COUGEJBKXBDQQE-RZIURPKCSA-N |
| XLogP | 2.21 |
| TPSA | 156.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|