C30H34N4O6S — CID 67901467
[1-[(2R)-2-amino-3-(3-carbamimidoylphenyl)-2-naphthalen-2-ylsulfonylpropanoyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-4-yl] hydrogen carbonate (PubChem CID 67901467) has the molecular formula C30H34N4O6S and a molecular weight of 578.69 g/mol. Its IUPAC name is [1-[(2R)-2-amino-3-(3-carbamimidoylphenyl)-2-naphthalen-2-ylsulfonylpropanoyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-4-yl] hydrogen carbonate.
| Compound Name | [1-[(2R)-2-amino-3-(3-carbamimidoylphenyl)-2-naphthalen-2-ylsulfonylpropanoyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67901467 |
| Molecular Formula | C30H34N4O6S |
| Molecular Weight | 578.69 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | [1-[(2R)-2-amino-3-(3-carbamimidoylphenyl)-2-naphthalen-2-ylsulfonylpropanoyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-4-yl] hydrogen carbonate |
| SMILES | [H]/N=C(\N)c1cccc(C[C@](N)(C(=O)N2CCC(OC(=O)O)C3CCCCC32)S(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C30H34N4O6S/c31-27(32)22-9-5-6-19(16-22)18-30(33,41(38,39)23-13-12-20-7-1-2-8-21(20)17-23)28(35)34-15-14-26(40-29(36)37)24-10-3-4-11-25(24)34/h1-2,5-9,12-13,16-17,24-26H,3-4,10-11,14-15,18,33H2,(H3,31,32)(H,36,37)/t24?,25?,26?,30-/m1/s1 |
| InChIKey | RYDKFVLWGFLWKP-NPEWAYGDSA-N |
| XLogP | 3.65 |
| TPSA | 176.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.69 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|