C17H22O6S — CID 67912851
2-[[4-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1,3-dioxolan-2-yl]methylsulfanyl]acetic acid (PubChem CID 67912851) has the molecular formula C17H22O6S and a molecular weight of 354.42 g/mol. Its IUPAC name is 2-[[4-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1,3-dioxolan-2-yl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[4-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1,3-dioxolan-2-yl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 67912851 |
| Molecular Formula | C17H22O6S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-[[4-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1,3-dioxolan-2-yl]methylsulfanyl]acetic acid |
| SMILES | C=CCc1ccc(OCC2COC(CSCC(=O)O)O2)c(OC)c1 |
| InChI | InChI=1S/C17H22O6S/c1-3-4-12-5-6-14(15(7-12)20-2)21-8-13-9-22-17(23-13)11-24-10-16(18)19/h3,5-7,13,17H,1,4,8-11H2,2H3,(H,18,19) |
| InChIKey | FGBHSTARARXKOK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|