C14H18N2O3 — CID 5252418
5-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 5252418) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | 5-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 5252418 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 5-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | C=CCc1ccc(OCC2CN=C(N)O2)c(OC)c1 |
| InChI | InChI=1S/C14H18N2O3/c1-3-4-10-5-6-12(13(7-10)17-2)18-9-11-8-16-14(15)19-11/h3,5-7,11H,1,4,8-9H2,2H3,(H2,15,16) |
| InChIKey | WWDCAQNFJNJFKF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|