C22H25KO2S — CID 67928450
potassium 2-octyl-9H-thioxanthene-1-carboxylate (PubChem CID 67928450) has the molecular formula C22H25KO2S and a molecular weight of 392.61 g/mol. Its IUPAC name is potassium 2-octyl-9H-thioxanthene-1-carboxylate.
| Compound Name | potassium 2-octyl-9H-thioxanthene-1-carboxylate |
|---|---|
| PubChem CID | 67928450 |
| Molecular Formula | C22H25KO2S |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | potassium 2-octyl-9H-thioxanthene-1-carboxylate |
| SMILES | CCCCCCCCc1ccc2c(c1C(=O)[O-])Cc1ccccc1S2.[K+] |
| InChI | InChI=1S/C22H26O2S.K/c1-2-3-4-5-6-7-10-16-13-14-20-18(21(16)22(23)24)15-17-11-8-9-12-19(17)25-20;/h8-9,11-14H,2-7,10,15H2,1H3,(H,23,24);/q;+1/p-1 |
| InChIKey | ZMDWWPNDUOCPGN-UHFFFAOYSA-M |
| XLogP | 2.01 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|