C17H24N4O5 — CID 67939303
(4R)-2,4-dihydroxy-5-oxo-4-[(2-phenylacetyl)amino]-5-piperazin-1-ylpentanamide (PubChem CID 67939303) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is (4R)-2,4-dihydroxy-5-oxo-4-[(2-phenylacetyl)amino]-5-piperazin-1-ylpentanamide.
| Compound Name | (4R)-2,4-dihydroxy-5-oxo-4-[(2-phenylacetyl)amino]-5-piperazin-1-ylpentanamide |
|---|---|
| PubChem CID | 67939303 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (4R)-2,4-dihydroxy-5-oxo-4-[(2-phenylacetyl)amino]-5-piperazin-1-ylpentanamide |
| SMILES | NC(=O)C(O)C[C@](O)(NC(=O)Cc1ccccc1)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C17H24N4O5/c18-15(24)13(22)11-17(26,16(25)21-8-6-19-7-9-21)20-14(23)10-12-4-2-1-3-5-12/h1-5,13,19,22,26H,6-11H2,(H2,18,24)(H,20,23)/t13?,17-/m1/s1 |
| InChIKey | CNITXNPYLNTVNX-LRHAYUFXSA-N |
| XLogP | -2.30 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|