C14H14N2O7 — CID 67941238
azetidine-2,3,4-trione;(4-nitrophenyl)methyl butanoate (PubChem CID 67941238) has the molecular formula C14H14N2O7 and a molecular weight of 322.27 g/mol. Its IUPAC name is azetidine-2,3,4-trione;(4-nitrophenyl)methyl butanoate.
| Compound Name | azetidine-2,3,4-trione;(4-nitrophenyl)methyl butanoate |
|---|---|
| PubChem CID | 67941238 |
| Molecular Formula | C14H14N2O7 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | azetidine-2,3,4-trione;(4-nitrophenyl)methyl butanoate |
| SMILES | CCCC(=O)OCc1ccc([N+](=O)[O-])cc1.O=c1[nH]c(=O)c1=O |
| InChI | InChI=1S/C11H13NO4.C3HNO3/c1-2-3-11(13)16-8-9-4-6-10(7-5-9)12(14)15;5-1-2(6)4-3(1)7/h4-7H,2-3,8H2,1H3;(H,4,6,7) |
| InChIKey | JNNPXULVYBJNFJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 136.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|