C20H20N6 — CID 6795361
N-[1-(4-propan-2-ylphenyl)ethylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 6795361) has the molecular formula C20H20N6 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[1-(4-propan-2-ylphenyl)ethylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[1-(4-propan-2-ylphenyl)ethylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 6795361 |
| Molecular Formula | C20H20N6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-[1-(4-propan-2-ylphenyl)ethylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CC(=NNc1nnc2c(n1)[nH]c1ccccc12)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C20H20N6/c1-12(2)14-8-10-15(11-9-14)13(3)23-25-20-22-19-18(24-26-20)16-6-4-5-7-17(16)21-19/h4-12H,1-3H3,(H2,21,22,25,26) |
| InChIKey | FHSCPCPBEVZFNJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|