C24H35N7O2 — CID 67969043
2-[(3R)-3-aminopiperidin-1-yl]-5-(3-aminopropylamino)-3-but-2-ynyl-N-[(4-methoxyphenyl)methyl]imidazole-4-carboxamide (PubChem CID 67969043) has the molecular formula C24H35N7O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-[(3R)-3-aminopiperidin-1-yl]-5-(3-aminopropylamino)-3-but-2-ynyl-N-[(4-methoxyphenyl)methyl]imidazole-4-carboxamide.
| Compound Name | 2-[(3R)-3-aminopiperidin-1-yl]-5-(3-aminopropylamino)-3-but-2-ynyl-N-[(4-methoxyphenyl)methyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 67969043 |
| Molecular Formula | C24H35N7O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | 2-[(3R)-3-aminopiperidin-1-yl]-5-(3-aminopropylamino)-3-but-2-ynyl-N-[(4-methoxyphenyl)methyl]imidazole-4-carboxamide |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)nc(NCCCN)c1C(=O)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H35N7O2/c1-3-4-15-31-21(23(32)28-16-18-8-10-20(33-2)11-9-18)22(27-13-6-12-25)29-24(31)30-14-5-7-19(26)17-30/h8-11,19,27H,5-7,12-17,25-26H2,1-2H3,(H,28,32)/t19-/m1/s1 |
| InChIKey | ONPITMABRWDORF-LJQANCHMSA-N |
| XLogP | 1.53 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|