C23H26N6O — CID 59857690
2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-N-(quinolin-3-ylmethyl)imidazole-4-carboxamide (PubChem CID 59857690) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-N-(quinolin-3-ylmethyl)imidazole-4-carboxamide.
| Compound Name | 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-N-(quinolin-3-ylmethyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 59857690 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-N-(quinolin-3-ylmethyl)imidazole-4-carboxamide |
| SMILES | CC#CCn1c(C(=O)NCc2cnc3ccccc3c2)cnc1N1CCCC(N)C1 |
| InChI | InChI=1S/C23H26N6O/c1-2-3-11-29-21(15-27-23(29)28-10-6-8-19(24)16-28)22(30)26-14-17-12-18-7-4-5-9-20(18)25-13-17/h4-5,7,9,12-13,15,19H,6,8,10-11,14,16,24H2,1H3,(H,26,30) |
| InChIKey | FRSXNAVSUWTGMU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|