C24H27N5O — CID 11603742
2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-N-methyl-N-naphthalen-1-ylimidazole-4-carboxamide (PubChem CID 11603742) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-N-methyl-N-naphthalen-1-ylimidazole-4-carboxamide.
| Compound Name | 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-N-methyl-N-naphthalen-1-ylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 11603742 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-(3-aminopiperidin-1-yl)-3-but-2-ynyl-N-methyl-N-naphthalen-1-ylimidazole-4-carboxamide |
| SMILES | CC#CCn1c(C(=O)N(C)c2cccc3ccccc23)cnc1N1CCCC(N)C1 |
| InChI | InChI=1S/C24H27N5O/c1-3-4-15-29-22(16-26-24(29)28-14-8-11-19(25)17-28)23(30)27(2)21-13-7-10-18-9-5-6-12-20(18)21/h5-7,9-10,12-13,16,19H,8,11,14-15,17,25H2,1-2H3 |
| InChIKey | RTIAFISXRMEOCR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|