C27H28N6O — CID 59857698
5-(3-aminopiperidin-1-yl)-4-but-2-ynyl-N-(phenanthren-9-ylmethyl)-1,2,4-triazole-3-carboxamide (PubChem CID 59857698) has the molecular formula C27H28N6O and a molecular weight of 452.56 g/mol. Its IUPAC name is 5-(3-aminopiperidin-1-yl)-4-but-2-ynyl-N-(phenanthren-9-ylmethyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-(3-aminopiperidin-1-yl)-4-but-2-ynyl-N-(phenanthren-9-ylmethyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 59857698 |
| Molecular Formula | C27H28N6O |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 5-(3-aminopiperidin-1-yl)-4-but-2-ynyl-N-(phenanthren-9-ylmethyl)-1,2,4-triazole-3-carboxamide |
| SMILES | CC#CCn1c(C(=O)NCc2cc3ccccc3c3ccccc23)nnc1N1CCCC(N)C1 |
| InChI | InChI=1S/C27H28N6O/c1-2-3-15-33-25(30-31-27(33)32-14-8-10-21(28)18-32)26(34)29-17-20-16-19-9-4-5-11-22(19)24-13-7-6-12-23(20)24/h4-7,9,11-13,16,21H,8,10,14-15,17-18,28H2,1H3,(H,29,34) |
| InChIKey | YTZACMLIUUIATQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|