C21H25N — CID 67978423
1-[(2S,4R)-4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl]piperidine (PubChem CID 67978423) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-[(2S,4R)-4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl]piperidine.
| Compound Name | 1-[(2S,4R)-4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl]piperidine |
|---|---|
| PubChem CID | 67978423 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 1-[(2S,4R)-4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl]piperidine |
| SMILES | c1ccc([C@H]2C[C@H](N3CCCCC3)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C21H25N/c1-3-9-17(10-4-1)21-16-19(22-13-7-2-8-14-22)15-18-11-5-6-12-20(18)21/h1,3-6,9-12,19,21H,2,7-8,13-16H2/t19-,21-/m1/s1 |
| InChIKey | SFLGTDMHQPGBGS-TZIWHRDSSA-N |
| XLogP | 4.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |