C23H32O2Si — CID 67982731
tert-butyl-[2-ethoxy-4-[(E)-3-phenylprop-1-enyl]phenoxy]-dimethylsilane (PubChem CID 67982731) has the molecular formula C23H32O2Si and a molecular weight of 368.59 g/mol. Its IUPAC name is tert-butyl-[2-ethoxy-4-[(E)-3-phenylprop-1-enyl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-ethoxy-4-[(E)-3-phenylprop-1-enyl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 67982731 |
| Molecular Formula | C23H32O2Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | tert-butyl-[2-ethoxy-4-[(E)-3-phenylprop-1-enyl]phenoxy]-dimethylsilane |
| SMILES | CCOc1cc(/C=C/Cc2ccccc2)ccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H32O2Si/c1-7-24-22-18-20(15-11-14-19-12-9-8-10-13-19)16-17-21(22)25-26(5,6)23(2,3)4/h8-13,15-18H,7,14H2,1-6H3/b15-11+ |
| InChIKey | LVPURRGBIAWIJV-RVDMUPIBSA-N |
| XLogP | 6.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|