C20H19N5O2S — CID 67984968
2-ethyl-8-methylsulfonyl-9-(3-phenylphenyl)purin-6-amine (PubChem CID 67984968) has the molecular formula C20H19N5O2S and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-ethyl-8-methylsulfonyl-9-(3-phenylphenyl)purin-6-amine.
| Compound Name | 2-ethyl-8-methylsulfonyl-9-(3-phenylphenyl)purin-6-amine |
|---|---|
| PubChem CID | 67984968 |
| Molecular Formula | C20H19N5O2S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-ethyl-8-methylsulfonyl-9-(3-phenylphenyl)purin-6-amine |
| SMILES | CCc1nc(N)c2nc(S(C)(=O)=O)n(-c3cccc(-c4ccccc4)c3)c2n1 |
| InChI | InChI=1S/C20H19N5O2S/c1-3-16-22-18(21)17-19(23-16)25(20(24-17)28(2,26)27)15-11-7-10-14(12-15)13-8-5-4-6-9-13/h4-12H,3H2,1-2H3,(H2,21,22,23) |
| InChIKey | GLTYKLUGZHPUJK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |